C25H26N4O3 — CID 136835844
4-hydroxy-6-methyl-3-[2-(4-piperazin-1-ylphenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]pyran-2-one (PubChem CID 136835844) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[2-(4-piperazin-1-ylphenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[2-(4-piperazin-1-ylphenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]pyran-2-one |
|---|---|
| PubChem CID | 136835844 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[2-(4-piperazin-1-ylphenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]pyran-2-one |
| SMILES | Cc1cc(O)c(C2=Nc3ccccc3NC(c3ccc(N4CCNCC4)cc3)C2)c(=O)o1 |
| InChI | InChI=1S/C25H26N4O3/c1-16-14-23(30)24(25(31)32-16)22-15-21(27-19-4-2-3-5-20(19)28-22)17-6-8-18(9-7-17)29-12-10-26-11-13-29/h2-9,14,21,26-27,30H,10-13,15H2,1H3 |
| InChIKey | ITWCLBAPBUNXFT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|