C14H11FN2OS — CID 136835872
7-(2-fluorophenyl)-2,6-dimethyl-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136835872) has the molecular formula C14H11FN2OS and a molecular weight of 274.32 g/mol. Its IUPAC name is 7-(2-fluorophenyl)-2,6-dimethyl-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 7-(2-fluorophenyl)-2,6-dimethyl-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136835872 |
| Molecular Formula | C14H11FN2OS |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 7-(2-fluorophenyl)-2,6-dimethyl-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(-c3ccccc3F)c(C)sc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H11FN2OS/c1-7-11(9-5-3-4-6-10(9)15)12-13(19-7)14(18)17-8(2)16-12/h3-6H,1-2H3,(H,16,17,18) |
| InChIKey | FQYXCALEXZFUOT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |