C15H9N3O2 — CID 136836017
3-[4-(2-pyridin-2-ylethynyl)phenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136836017) has the molecular formula C15H9N3O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-[4-(2-pyridin-2-ylethynyl)phenyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[4-(2-pyridin-2-ylethynyl)phenyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136836017 |
| Molecular Formula | C15H9N3O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-[4-(2-pyridin-2-ylethynyl)phenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=c1[nH]c(-c2ccc(C#Cc3ccccn3)cc2)no1 |
| InChI | InChI=1S/C15H9N3O2/c19-15-17-14(18-20-15)12-7-4-11(5-8-12)6-9-13-3-1-2-10-16-13/h1-5,7-8,10H,(H,17,18,19) |
| InChIKey | MYQYXSWXGSLRRL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|