About CID 136836120
CID 136836120 (PubChem CID 136836120) has the molecular formula C14H21Si
and a molecular weight of 217.41 g/mol.
Molecular Properties
| Compound Name | CID 136836120 |
| PubChem CID | 136836120 |
| Molecular Formula | C14H21Si |
| Molecular Weight | 217.41 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | — |
| SMILES | CC(C)=CCC[Si](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H21Si/c1-12(2)6-5-11-15(4)14-9-7-13(3)8-10-14/h6-10H,5,11H2,1-4H3 |
| InChIKey | KQQPONOTNJZSNR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 136836120 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136836120?
The IUPAC name of CID 136836120 (CID 136836120) is not available.
What is the SMILES notation for CID 136836120?
The canonical SMILES for CID 136836120 is CC(C)=CCC[Si](C)c1ccc(C)cc1.
What is the InChIKey of CID 136836120?
The InChIKey is KQQPONOTNJZSNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Si/c1-12(2)6-5-11-15(4)14-9-7-13(3)8-10-14/h6-10H,5,11H2,1-4H3.
What are the key properties of CID 136836120?
CID 136836120 has a molecular weight of 217.41 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136836120 is sourced from PubChem (CID 136836120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).