C22H22N6O5S — CID 136836293
(3'aS)-7'-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione (PubChem CID 136836293) has the molecular formula C22H22N6O5S and a molecular weight of 482.52 g/mol. Its IUPAC name is (3'aS)-7'-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (3'aS)-7'-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 136836293 |
| Molecular Formula | C22H22N6O5S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (3'aS)-7'-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C2(Cc3cc(/N=C/c4c(O)[nH]c(=S)[nH]c4=O)ccc3N3CCC[C@H]32)C1=O |
| InChI | InChI=1S/C22H22N6O5S/c1-26-18(31)22(19(32)27(2)21(26)33)9-11-8-12(5-6-14(11)28-7-3-4-15(22)28)23-10-13-16(29)24-20(34)25-17(13)30/h5-6,8,10,15H,3-4,7,9H2,1-2H3,(H3,24,25,29,30,34)/b23-10+/t15-/m0/s1 |
| InChIKey | GMWHUOIUTGULCB-MQEPLNOPSA-N |
| XLogP | 1.45 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|