C14H25N5 — CID 136837660
3-(7-cyclohexyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propan-1-amine (PubChem CID 136837660) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 3-(7-cyclohexyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propan-1-amine.
| Compound Name | 3-(7-cyclohexyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 136837660 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 3-(7-cyclohexyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propan-1-amine |
| SMILES | NCCCc1nc2n(n1)C(C1CCCCC1)CCN2 |
| InChI | InChI=1S/C14H25N5/c15-9-4-7-13-17-14-16-10-8-12(19(14)18-13)11-5-2-1-3-6-11/h11-12H,1-10,15H2,(H,16,17,18) |
| InChIKey | KHAKPQJGRUOEMY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |