C13H20F3N5 — CID 136837676
4-[5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]cyclohexan-1-amine (PubChem CID 136837676) has the molecular formula C13H20F3N5 and a molecular weight of 303.33 g/mol. Its IUPAC name is 4-[5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]cyclohexan-1-amine.
| Compound Name | 4-[5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 136837676 |
| Molecular Formula | C13H20F3N5 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4-[5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]cyclohexan-1-amine |
| SMILES | CC1CC(C(F)(F)F)n2nc(C3CCC(N)CC3)nc2N1 |
| InChI | InChI=1S/C13H20F3N5/c1-7-6-10(13(14,15)16)21-12(18-7)19-11(20-21)8-2-4-9(17)5-3-8/h7-10H,2-6,17H2,1H3,(H,18,19,20) |
| InChIKey | GNCIBGWLOYGENT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |