C7H10F2N4O — CID 136837707
[7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methanol (PubChem CID 136837707) has the molecular formula C7H10F2N4O and a molecular weight of 204.18 g/mol. Its IUPAC name is [7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methanol.
| Compound Name | [7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methanol |
|---|---|
| PubChem CID | 136837707 |
| Molecular Formula | C7H10F2N4O |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | [7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methanol |
| SMILES | OCc1nc2n(n1)C(C(F)F)CCN2 |
| InChI | InChI=1S/C7H10F2N4O/c8-6(9)4-1-2-10-7-11-5(3-14)12-13(4)7/h4,6,14H,1-3H2,(H,10,11,12) |
| InChIKey | JJSSPGCJJJQCNL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |