C8H11F3N4O — CID 136837723
[5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methanol (PubChem CID 136837723) has the molecular formula C8H11F3N4O and a molecular weight of 236.20 g/mol. Its IUPAC name is [5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methanol.
| Compound Name | [5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methanol |
|---|---|
| PubChem CID | 136837723 |
| Molecular Formula | C8H11F3N4O |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | [5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methanol |
| SMILES | CC1CC(C(F)(F)F)n2nc(CO)nc2N1 |
| InChI | InChI=1S/C8H11F3N4O/c1-4-2-5(8(9,10)11)15-7(12-4)13-6(3-16)14-15/h4-5,16H,2-3H2,1H3,(H,12,13,14) |
| InChIKey | BJKGSENCEWMXHY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |