C16H29N3O2 — CID 136838293
7-(dimethoxymethyl)-2-heptan-3-yl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 136838293) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 7-(dimethoxymethyl)-2-heptan-3-yl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-(dimethoxymethyl)-2-heptan-3-yl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136838293 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 7-(dimethoxymethyl)-2-heptan-3-yl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | CCCCC(CC)c1cc2n(n1)C(C(OC)OC)CCN2 |
| InChI | InChI=1S/C16H29N3O2/c1-5-7-8-12(6-2)13-11-15-17-10-9-14(19(15)18-13)16(20-3)21-4/h11-12,14,16-17H,5-10H2,1-4H3 |
| InChIKey | SQGRECXWCKQJJW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|