C17H24N4 — CID 136838415
5-(2-butyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl)-2-methylaniline (PubChem CID 136838415) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 5-(2-butyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl)-2-methylaniline.
| Compound Name | 5-(2-butyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl)-2-methylaniline |
|---|---|
| PubChem CID | 136838415 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 5-(2-butyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl)-2-methylaniline |
| SMILES | CCCCc1cc2n(n1)C(c1ccc(C)c(N)c1)CCN2 |
| InChI | InChI=1S/C17H24N4/c1-3-4-5-14-11-17-19-9-8-16(21(17)20-14)13-7-6-12(2)15(18)10-13/h6-7,10-11,16,19H,3-5,8-9,18H2,1-2H3 |
| InChIKey | CNIATFJWEOEOOK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|