C14H16N6S — CID 136839464
7-(1-methylpyrazol-4-yl)-2-(3-methylthiophen-2-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136839464) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is 7-(1-methylpyrazol-4-yl)-2-(3-methylthiophen-2-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(1-methylpyrazol-4-yl)-2-(3-methylthiophen-2-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136839464 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 7-(1-methylpyrazol-4-yl)-2-(3-methylthiophen-2-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccsc1-c1nc2n(n1)C(c1cnn(C)c1)CCN2 |
| InChI | InChI=1S/C14H16N6S/c1-9-4-6-21-12(9)13-17-14-15-5-3-11(20(14)18-13)10-7-16-19(2)8-10/h4,6-8,11H,3,5H2,1-2H3,(H,15,17,18) |
| InChIKey | LVDLQCKFXHUWJU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |