C15H19N3 — CID 136839872
7-(4-propylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine (PubChem CID 136839872) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 7-(4-propylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine.
| Compound Name | 7-(4-propylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 136839872 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 7-(4-propylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine |
| SMILES | CCCc1ccc(C2CCn3ccnc3N2)cc1 |
| InChI | InChI=1S/C15H19N3/c1-2-3-12-4-6-13(7-5-12)14-8-10-18-11-9-16-15(18)17-14/h4-7,9,11,14H,2-3,8,10H2,1H3,(H,16,17) |
| InChIKey | VMEFBMPNMKIQSU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |