C15H19N3 — CID 136840482
2,5,7-trimethyl-3-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 136840482) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2,5,7-trimethyl-3-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | 2,5,7-trimethyl-3-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136840482 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2,5,7-trimethyl-3-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1nn2c(c1-c1ccccc1)NC(C)CC2C |
| InChI | InChI=1S/C15H19N3/c1-10-9-11(2)18-15(16-10)14(12(3)17-18)13-7-5-4-6-8-13/h4-8,10-11,16H,9H2,1-3H3 |
| InChIKey | QAIMGBQTHYYESP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |