C14H16N6 — CID 136841318
3,5-dimethyl-10-pyridin-4-yl-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene (PubChem CID 136841318) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3,5-dimethyl-10-pyridin-4-yl-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene.
| Compound Name | 3,5-dimethyl-10-pyridin-4-yl-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene |
|---|---|
| PubChem CID | 136841318 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3,5-dimethyl-10-pyridin-4-yl-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene |
| SMILES | Cc1nn(C)c2nn3c(c12)NCC(c1ccncc1)C3 |
| InChI | InChI=1S/C14H16N6/c1-9-12-13-16-7-11(10-3-5-15-6-4-10)8-20(13)18-14(12)19(2)17-9/h3-6,11,16H,7-8H2,1-2H3 |
| InChIKey | BAJHEWDQCLVZMS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |