C11H14N4 — CID 136841448
2-methyl-1,2,3,4-tetrahydropyrimido[1,2-b]indazol-9-amine (PubChem CID 136841448) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-methyl-1,2,3,4-tetrahydropyrimido[1,2-b]indazol-9-amine.
| Compound Name | 2-methyl-1,2,3,4-tetrahydropyrimido[1,2-b]indazol-9-amine |
|---|---|
| PubChem CID | 136841448 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-methyl-1,2,3,4-tetrahydropyrimido[1,2-b]indazol-9-amine |
| SMILES | CC1CCn2nc3ccc(N)cc3c2N1 |
| InChI | InChI=1S/C11H14N4/c1-7-4-5-15-11(13-7)9-6-8(12)2-3-10(9)14-15/h2-3,6-7,13H,4-5,12H2,1H3 |
| InChIKey | GAMROZIROZRHAZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|