C7H7ClF3N3OS — CID 136842340
5-chloro-4-[2-(trifluoromethylsulfanyl)ethylamino]-1H-pyrimidin-6-one (PubChem CID 136842340) has the molecular formula C7H7ClF3N3OS and a molecular weight of 273.67 g/mol. Its IUPAC name is 5-chloro-4-[2-(trifluoromethylsulfanyl)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[2-(trifluoromethylsulfanyl)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842340 |
| Molecular Formula | C7H7ClF3N3OS |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 5-chloro-4-[2-(trifluoromethylsulfanyl)ethylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCSC(F)(F)F)c1Cl |
| InChI | InChI=1S/C7H7ClF3N3OS/c8-4-5(13-3-14-6(4)15)12-1-2-16-7(9,10)11/h3H,1-2H2,(H2,12,13,14,15) |
| InChIKey | BDHVLWDCAOWMSM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|