C9H12F2N2O2 — CID 136842422
2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 136842422) has the molecular formula C9H12F2N2O2 and a molecular weight of 218.20 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842422 |
| Molecular Formula | C9H12F2N2O2 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(CCOCC(F)F)n1 |
| InChI | InChI=1S/C9H12F2N2O2/c1-6-4-9(14)13-8(12-6)2-3-15-5-7(10)11/h4,7H,2-3,5H2,1H3,(H,12,13,14) |
| InChIKey | SOCSYEHXUXQZDI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|