C12H17F3N2O2 — CID 136842427
4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 136842427) has the molecular formula C12H17F3N2O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is 4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842427 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)c1cc(=O)[nH]c(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N2O2/c1-11(2,3)8-6-10(18)17-9(16-8)4-5-19-7-12(13,14)15/h6H,4-5,7H2,1-3H3,(H,16,17,18) |
| InChIKey | KPUKQUYVJNWJCB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|