C9H10F4N2O2 — CID 136842445
5-fluoro-4-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 136842445) has the molecular formula C9H10F4N2O2 and a molecular weight of 254.18 g/mol. Its IUPAC name is 5-fluoro-4-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-fluoro-4-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842445 |
| Molecular Formula | C9H10F4N2O2 |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-fluoro-4-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(CCOCC(F)(F)F)[nH]c(=O)c1F |
| InChI | InChI=1S/C9H10F4N2O2/c1-5-7(10)8(16)15-6(14-5)2-3-17-4-9(11,12)13/h2-4H2,1H3,(H,14,15,16) |
| InChIKey | BSXMZDLFEGPBSL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|