C11H15BrF2N2O2 — CID 136842451
5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1H-pyrimidin-6-one (PubChem CID 136842451) has the molecular formula C11H15BrF2N2O2 and a molecular weight of 325.15 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842451 |
| Molecular Formula | C11H15BrF2N2O2 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1nc(CCOCC(F)F)[nH]c(=O)c1Br |
| InChI | InChI=1S/C11H15BrF2N2O2/c1-2-3-7-10(12)11(17)16-9(15-7)4-5-18-6-8(13)14/h8H,2-6H2,1H3,(H,15,16,17) |
| InChIKey | YQHINGHIUZBADJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|