C11H15F2IN2O2 — CID 136842462
2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136842462) has the molecular formula C11H15F2IN2O2 and a molecular weight of 372.15 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842462 |
| Molecular Formula | C11H15F2IN2O2 |
| Molecular Weight | 372.15 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(CCOCC(F)F)[nH]c(=O)c1I |
| InChI | InChI=1S/C11H15F2IN2O2/c1-6(2)10-9(14)11(17)16-8(15-10)3-4-18-5-7(12)13/h6-7H,3-5H2,1-2H3,(H,15,16,17) |
| InChIKey | GYTDXQSUJIBLKR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|