C12H17BrF2N2O2 — CID 136842471
5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1H-pyrimidin-6-one (PubChem CID 136842471) has the molecular formula C12H17BrF2N2O2 and a molecular weight of 339.18 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842471 |
| Molecular Formula | C12H17BrF2N2O2 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)Cc1nc(CCOCC(F)F)[nH]c(=O)c1Br |
| InChI | InChI=1S/C12H17BrF2N2O2/c1-7(2)5-8-11(13)12(18)17-10(16-8)3-4-19-6-9(14)15/h7,9H,3-6H2,1-2H3,(H,16,17,18) |
| InChIKey | AHXIDTGYHJYOEJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|