C12H17F2IN2O2 — CID 136842473
2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-(2-methylpropyl)-1H-pyrimidin-6-one (PubChem CID 136842473) has the molecular formula C12H17F2IN2O2 and a molecular weight of 386.18 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-(2-methylpropyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-(2-methylpropyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842473 |
| Molecular Formula | C12H17F2IN2O2 |
| Molecular Weight | 386.18 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-(2-methylpropyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)Cc1nc(CCOCC(F)F)[nH]c(=O)c1I |
| InChI | InChI=1S/C12H17F2IN2O2/c1-7(2)5-8-11(15)12(18)17-10(16-8)3-4-19-6-9(13)14/h7,9H,3-6H2,1-2H3,(H,16,17,18) |
| InChIKey | RUKXZSGBWCUOHD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|