C6H8F2N2O3 — CID 136842486
3-[2-(2,2-difluoroethoxy)ethyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136842486) has the molecular formula C6H8F2N2O3 and a molecular weight of 194.14 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136842486 |
| Molecular Formula | C6H8F2N2O3 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=c1[nH]c(CCOCC(F)F)no1 |
| InChI | InChI=1S/C6H8F2N2O3/c7-4(8)3-12-2-1-5-9-6(11)13-10-5/h4H,1-3H2,(H,9,10,11) |
| InChIKey | GLOXXLQZRHVTTM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|