C11H13F3N2O4 — CID 136842488
2-[4-methyl-6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136842488) has the molecular formula C11H13F3N2O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-[4-methyl-6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-methyl-6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136842488 |
| Molecular Formula | C11H13F3N2O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[4-methyl-6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-5-yl]acetic acid |
| SMILES | Cc1nc(CCOCC(F)(F)F)[nH]c(=O)c1CC(=O)O |
| InChI | InChI=1S/C11H13F3N2O4/c1-6-7(4-9(17)18)10(19)16-8(15-6)2-3-20-5-11(12,13)14/h2-5H2,1H3,(H,17,18)(H,15,16,19) |
| InChIKey | GLWJBIHMMSEIAX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|