About ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate
ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate (PubChem CID 136842491) has the molecular formula C12H17F2N3O4
and a molecular weight of 305.28 g/mol. Its IUPAC name is ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate |
| PubChem CID | 136842491 |
| Molecular Formula | C12H17F2N3O4 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate |
| SMILES | CCOC(=O)Cc1c(N)nc(CCOCC(F)F)[nH]c1=O |
| InChI | InChI=1S/C12H17F2N3O4/c1-2-21-10(18)5-7-11(15)16-9(17-12(7)19)3-4-20-6-8(13)14/h8H,2-6H2,1H3,(H3,15,16,17,19) |
| InChIKey | LADWKTQRBQDPGC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate?
The IUPAC name of ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate (CID 136842491) is ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate.
What is the SMILES notation for ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate?
The canonical SMILES for ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate is CCOC(=O)Cc1c(N)nc(CCOCC(F)F)[nH]c1=O.
What is the InChIKey of ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate?
The InChIKey is LADWKTQRBQDPGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3O4/c1-2-21-10(18)5-7-11(15)16-9(17-12(7)19)3-4-20-6-8(13)14/h8H,2-6H2,1H3,(H3,15,16,17,19).
What are the key properties of ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate?
ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate has a molecular weight of 305.28 g/mol, XLogP of 0.28, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetate is sourced from PubChem (CID 136842491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).