C11H10F3N3O3 — CID 136842506
2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyridin-3-ol (PubChem CID 136842506) has the molecular formula C11H10F3N3O3 and a molecular weight of 289.21 g/mol. Its IUPAC name is 2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyridin-3-ol.
| Compound Name | 2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 136842506 |
| Molecular Formula | C11H10F3N3O3 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
| SMILES | Oc1cccnc1-c1nc(CCOCC(F)(F)F)no1 |
| InChI | InChI=1S/C11H10F3N3O3/c12-11(13,14)6-19-5-3-8-16-10(20-17-8)9-7(18)2-1-4-15-9/h1-2,4,18H,3,5-6H2 |
| InChIKey | MBMWRSBQRGHNRJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|