C10H15F2N3O2 — CID 136842536
2-[2-(2,2-difluoroethoxy)ethyl]-4-(methylaminomethyl)-1H-pyrimidin-6-one (PubChem CID 136842536) has the molecular formula C10H15F2N3O2 and a molecular weight of 247.24 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-(methylaminomethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-(methylaminomethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842536 |
| Molecular Formula | C10H15F2N3O2 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-(methylaminomethyl)-1H-pyrimidin-6-one |
| SMILES | CNCc1cc(=O)[nH]c(CCOCC(F)F)n1 |
| InChI | InChI=1S/C10H15F2N3O2/c1-13-5-7-4-10(16)15-9(14-7)2-3-17-6-8(11)12/h4,8,13H,2-3,5-6H2,1H3,(H,14,15,16) |
| InChIKey | AKFJEUHWLUSZIP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|