C12H18F3N3O2 — CID 136842539
4-(propylaminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 136842539) has the molecular formula C12H18F3N3O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is 4-(propylaminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 4-(propylaminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842539 |
| Molecular Formula | C12H18F3N3O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-(propylaminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | CCCNCc1cc(=O)[nH]c(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H18F3N3O2/c1-2-4-16-7-9-6-11(19)18-10(17-9)3-5-20-8-12(13,14)15/h6,16H,2-5,7-8H2,1H3,(H,17,18,19) |
| InChIKey | SPLYSPCVCZIBLL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|