C24H32N2O2S — CID 136843162
N-[(1R)-1-(1-adamantyl)ethyl]-5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine (PubChem CID 136843162) has the molecular formula C24H32N2O2S and a molecular weight of 412.60 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 136843162 |
| Molecular Formula | C24H32N2O2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccc(C)c(C)c2)S(=O)(=O)N/C1=N/[C@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32N2O2S/c1-14-5-6-21(7-15(14)2)22-16(3)23(26-29(22,27)28)25-17(4)24-11-18-8-19(12-24)10-20(9-18)13-24/h5-7,17-20H,8-13H2,1-4H3,(H,25,26)/t17-,18?,19?,20?,24?/m1/s1 |
| InChIKey | OXULIWMRZZAYMV-OQOKOFKUSA-N |
| XLogP | 4.97 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|