C25H34N2O2S — CID 136843176
N-[(1S)-1-(1-adamantyl)ethyl]-4-methyl-1,1-dioxo-5-(4-propan-2-ylphenyl)-1,2-thiazol-3-imine (PubChem CID 136843176) has the molecular formula C25H34N2O2S and a molecular weight of 426.63 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-4-methyl-1,1-dioxo-5-(4-propan-2-ylphenyl)-1,2-thiazol-3-imine.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-methyl-1,1-dioxo-5-(4-propan-2-ylphenyl)-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 136843176 |
| Molecular Formula | C25H34N2O2S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-methyl-1,1-dioxo-5-(4-propan-2-ylphenyl)-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccc(C(C)C)cc2)S(=O)(=O)N/C1=N/[C@@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H34N2O2S/c1-15(2)21-5-7-22(8-6-21)23-16(3)24(27-30(23,28)29)26-17(4)25-12-18-9-19(13-25)11-20(10-18)14-25/h5-8,15,17-20H,9-14H2,1-4H3,(H,26,27)/t17-,18?,19?,20?,25?/m0/s1 |
| InChIKey | JYAAUZRTTZMRKP-SELVFMLMSA-N |
| XLogP | 5.48 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|