About 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide
3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide (PubChem CID 136843228) has the molecular formula C9H13ClN4O2
and a molecular weight of 244.68 g/mol. Its IUPAC name is 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide |
| PubChem CID | 136843228 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNc1nc[nH]c(=O)c1Cl)C(N)=O |
| InChI | InChI=1S/C9H13ClN4O2/c1-9(2,8(11)16)3-12-6-5(10)7(15)14-4-13-6/h4H,3H2,1-2H3,(H2,11,16)(H2,12,13,14,15) |
| InChIKey | WYRCTAPEEISNOJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide?
The IUPAC name of 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide (CID 136843228) is 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide.
What is the SMILES notation for 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide?
The canonical SMILES for 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide is CC(C)(CNc1nc[nH]c(=O)c1Cl)C(N)=O.
What is the InChIKey of 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide?
The InChIKey is WYRCTAPEEISNOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN4O2/c1-9(2,8(11)16)3-12-6-5(10)7(15)14-4-13-6/h4H,3H2,1-2H3,(H2,11,16)(H2,12,13,14,15).
What are the key properties of 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide?
3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide has a molecular weight of 244.68 g/mol, XLogP of 0.35, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2,2-dimethylpropanamide is sourced from PubChem (CID 136843228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).