C10H16N4O2 — CID 136843239
N,2,2-trimethyl-3-[(6-oxo-1H-pyrimidin-4-yl)amino]propanamide (PubChem CID 136843239) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is N,2,2-trimethyl-3-[(6-oxo-1H-pyrimidin-4-yl)amino]propanamide.
| Compound Name | N,2,2-trimethyl-3-[(6-oxo-1H-pyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 136843239 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N,2,2-trimethyl-3-[(6-oxo-1H-pyrimidin-4-yl)amino]propanamide |
| SMILES | CNC(=O)C(C)(C)CNc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C10H16N4O2/c1-10(2,9(16)11-3)5-12-7-4-8(15)14-6-13-7/h4,6H,5H2,1-3H3,(H,11,16)(H2,12,13,14,15) |
| InChIKey | WUZIPTNQDDCCLZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |