C15H11Cl2N3OS2 — CID 136843618
(2Z,5S)-5-[(2,3-dichlorophenyl)methyl]-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 136843618) has the molecular formula C15H11Cl2N3OS2 and a molecular weight of 384.31 g/mol. Its IUPAC name is (2Z,5S)-5-[(2,3-dichlorophenyl)methyl]-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5S)-5-[(2,3-dichlorophenyl)methyl]-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136843618 |
| Molecular Formula | C15H11Cl2N3OS2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | (2Z,5S)-5-[(2,3-dichlorophenyl)methyl]-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/N=C\c2cccs2)S[C@H]1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H11Cl2N3OS2/c16-11-5-1-3-9(13(11)17)7-12-14(21)19-15(23-12)20-18-8-10-4-2-6-22-10/h1-6,8,12H,7H2,(H,19,20,21)/b18-8-/t12-/m0/s1 |
| InChIKey | NUICNRUIBGARID-QTPLJXKRSA-N |
| XLogP | 4.22 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|