C23H22ClN3O5 — CID 136845221
ethyl 2-[(4-chlorophenyl)diazenyl]-3-hydroxy-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinoline-1-carboxylate (PubChem CID 136845221) has the molecular formula C23H22ClN3O5 and a molecular weight of 455.90 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)diazenyl]-3-hydroxy-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinoline-1-carboxylate.
| Compound Name | ethyl 2-[(4-chlorophenyl)diazenyl]-3-hydroxy-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 136845221 |
| Molecular Formula | C23H22ClN3O5 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)diazenyl]-3-hydroxy-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinoline-1-carboxylate |
| SMILES | CCOC(=O)c1c(/N=N/c2ccc(Cl)cc2)c(O)n2c1-c1cc(OC)c(OC)cc1CC2 |
| InChI | InChI=1S/C23H22ClN3O5/c1-4-32-23(29)19-20(26-25-15-7-5-14(24)6-8-15)22(28)27-10-9-13-11-17(30-2)18(31-3)12-16(13)21(19)27/h5-8,11-12,28H,4,9-10H2,1-3H3/b26-25+ |
| InChIKey | BALZAUMNFFBMMS-OCEACIFDSA-N |
| XLogP | 5.68 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|