C36H34N6O3 — CID 136846237
(17S)-N-(2,4-dimethylphenyl)-15-methyl-13-phenyl-17-(3,4,5-trimethoxyphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine (PubChem CID 136846237) has the molecular formula C36H34N6O3 and a molecular weight of 598.71 g/mol. Its IUPAC name is (17S)-N-(2,4-dimethylphenyl)-15-methyl-13-phenyl-17-(3,4,5-trimethoxyphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine.
| Compound Name | (17S)-N-(2,4-dimethylphenyl)-15-methyl-13-phenyl-17-(3,4,5-trimethoxyphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine |
|---|---|
| PubChem CID | 136846237 |
| Molecular Formula | C36H34N6O3 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | (17S)-N-(2,4-dimethylphenyl)-15-methyl-13-phenyl-17-(3,4,5-trimethoxyphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine |
| SMILES | COc1cc([C@H]2c3c(C)nn(-c4ccccc4)c3N=C3/C(=N/c4ccc(C)cc4C)Nc4ccccc4N32)cc(OC)c1OC |
| InChI | InChI=1S/C36H34N6O3/c1-21-16-17-26(22(2)18-21)37-34-36-39-35-31(23(3)40-42(35)25-12-8-7-9-13-25)32(41(36)28-15-11-10-14-27(28)38-34)24-19-29(43-4)33(45-6)30(20-24)44-5/h7-20,32H,1-6H3,(H,37,38)/t32-/m0/s1 |
| InChIKey | KGXKYNAJSSDOJL-YTTGMZPUSA-N |
| XLogP | 7.62 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|