C18H24N4O — CID 136847222
4-(1H-benzimidazol-2-yl)-1-[(2S)-heptan-2-yl]-5-imino-2H-pyrrol-3-ol (PubChem CID 136847222) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1-[(2S)-heptan-2-yl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-(1H-benzimidazol-2-yl)-1-[(2S)-heptan-2-yl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136847222 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1-[(2S)-heptan-2-yl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccccc3[nH]2)=C(O)CN1[C@@H](C)CCCCC |
| InChI | InChI=1S/C18H24N4O/c1-3-4-5-8-12(2)22-11-15(23)16(17(22)19)18-20-13-9-6-7-10-14(13)21-18/h6-7,9-10,12,19,23H,3-5,8,11H2,1-2H3,(H,20,21)/b19-17-/t12-/m0/s1 |
| InChIKey | VLKWGGUCJIQMCJ-LCIOQVQZSA-N |
| XLogP | 4.09 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|