About 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one
5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136847973) has the molecular formula C11H20N4O2
and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 136847973 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)C(CCO)Nc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C11H20N4O2/c1-11(2,3)7(4-5-16)15-9-8(12)10(17)14-6-13-9/h6-7,16H,4-5,12H2,1-3H3,(H2,13,14,15,17) |
| InChIKey | RPJQXDTWZGQFDG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one (CID 136847973) is 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one is CC(C)(C)C(CCO)Nc1nc[nH]c(=O)c1N.
What is the InChIKey of 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one?
The InChIKey is RPJQXDTWZGQFDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O2/c1-11(2,3)7(4-5-16)15-9-8(12)10(17)14-6-13-9/h6-7,16H,4-5,12H2,1-3H3,(H2,13,14,15,17).
What are the key properties of 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one?
5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one has a molecular weight of 240.31 g/mol, XLogP of 0.56, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 136847973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).