C14H22N4S — CID 136848160
4-tert-butyl-N-[(2-methylpyrimidin-4-yl)methyl]-1,3-thiazinan-2-imine (PubChem CID 136848160) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2-methylpyrimidin-4-yl)methyl]-1,3-thiazinan-2-imine.
| Compound Name | 4-tert-butyl-N-[(2-methylpyrimidin-4-yl)methyl]-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136848160 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-tert-butyl-N-[(2-methylpyrimidin-4-yl)methyl]-1,3-thiazinan-2-imine |
| SMILES | Cc1nccc(C/N=C2/NC(C(C)(C)C)CCS2)n1 |
| InChI | InChI=1S/C14H22N4S/c1-10-15-7-5-11(17-10)9-16-13-18-12(6-8-19-13)14(2,3)4/h5,7,12H,6,8-9H2,1-4H3,(H,16,18) |
| InChIKey | BASWUJAMVJMDFY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|