C11H17ClIN3O — CID 136848623
4-[(1-chloro-4,4-dimethylpentan-3-yl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136848623) has the molecular formula C11H17ClIN3O and a molecular weight of 369.63 g/mol. Its IUPAC name is 4-[(1-chloro-4,4-dimethylpentan-3-yl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(1-chloro-4,4-dimethylpentan-3-yl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136848623 |
| Molecular Formula | C11H17ClIN3O |
| Molecular Weight | 369.63 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 4-[(1-chloro-4,4-dimethylpentan-3-yl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)C(CCCl)Nc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C11H17ClIN3O/c1-11(2,3)7(4-5-12)16-9-8(13)10(17)15-6-14-9/h6-7H,4-5H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | KKZBXFOTVQQLBI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.63 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|