C10H17BrN4O — CID 136848628
4-[(1-amino-4-methylpentan-3-yl)amino]-5-bromo-1H-pyrimidin-6-one (PubChem CID 136848628) has the molecular formula C10H17BrN4O and a molecular weight of 289.18 g/mol. Its IUPAC name is 4-[(1-amino-4-methylpentan-3-yl)amino]-5-bromo-1H-pyrimidin-6-one.
| Compound Name | 4-[(1-amino-4-methylpentan-3-yl)amino]-5-bromo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136848628 |
| Molecular Formula | C10H17BrN4O |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-[(1-amino-4-methylpentan-3-yl)amino]-5-bromo-1H-pyrimidin-6-one |
| SMILES | CC(C)C(CCN)Nc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C10H17BrN4O/c1-6(2)7(3-4-12)15-9-8(11)10(16)14-5-13-9/h5-7H,3-4,12H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | NROXGDUWMYTVCS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |