C17H23N5O4 — CID 136848747
(5S)-5-[2-(2-methyl-4-oxo-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]-3-propylimidazolidine-2,4-dione (PubChem CID 136848747) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (5S)-5-[2-(2-methyl-4-oxo-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]-3-propylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-(2-methyl-4-oxo-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]-3-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 136848747 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (5S)-5-[2-(2-methyl-4-oxo-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]-3-propylimidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)N[C@@H](CC(=O)N2CCc3nc(C)[nH]c(=O)c3CC2)C1=O |
| InChI | InChI=1S/C17H23N5O4/c1-3-6-22-16(25)13(20-17(22)26)9-14(23)21-7-4-11-12(5-8-21)18-10(2)19-15(11)24/h13H,3-9H2,1-2H3,(H,20,26)(H,18,19,24)/t13-/m0/s1 |
| InChIKey | FLHDXGVOBRNAFQ-ZDUSSCGKSA-N |
| XLogP | -0.27 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|