About CID 136849473
CID 136849473 (PubChem CID 136849473) has the molecular formula C18H38O5Si
and a molecular weight of 362.58 g/mol.
Molecular Properties
| Compound Name | CID 136849473 |
| PubChem CID | 136849473 |
| Molecular Formula | C18H38O5Si |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | — |
| SMILES | CCCCCCCCOCCOCCOCCOCCO[Si]CC |
| InChI | InChI=1S/C18H38O5Si/c1-3-5-6-7-8-9-10-19-11-12-20-13-14-21-15-16-22-17-18-23-24-4-2/h3-18H2,1-2H3 |
| InChIKey | HPMTZTHMRKBNOB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136849473 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136849473?
The IUPAC name of CID 136849473 (CID 136849473) is not available.
What is the SMILES notation for CID 136849473?
The canonical SMILES for CID 136849473 is CCCCCCCCOCCOCCOCCOCCO[Si]CC.
What is the InChIKey of CID 136849473?
The InChIKey is HPMTZTHMRKBNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O5Si/c1-3-5-6-7-8-9-10-19-11-12-20-13-14-21-15-16-22-17-18-23-24-4-2/h3-18H2,1-2H3.
What are the key properties of CID 136849473?
CID 136849473 has a molecular weight of 362.58 g/mol, XLogP of 3.49, 21 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136849473 is sourced from PubChem (CID 136849473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).