About 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide
3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide (PubChem CID 136849720) has the molecular formula C6H8N4O4
and a molecular weight of 200.15 g/mol. Its IUPAC name is 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide.
Molecular Properties
| Compound Name | 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide |
| PubChem CID | 136849720 |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CN=C1NC(=O)C(=O)N1 |
| InChI | InChI=1S/C6H8N4O4/c7-3(12)2(11)1-8-6-9-4(13)5(14)10-6/h2,11H,1H2,(H2,7,12)(H2,8,9,10,13,14) |
| InChIKey | GNOSWXCBIGYNQT-UHFFFAOYSA-N |
| XLogP | -3.57 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide?
The IUPAC name of 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide (CID 136849720) is 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide.
What is the SMILES notation for 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide?
The canonical SMILES for 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide is NC(=O)C(O)CN=C1NC(=O)C(=O)N1.
What is the InChIKey of 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide?
The InChIKey is GNOSWXCBIGYNQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O4/c7-3(12)2(11)1-8-6-9-4(13)5(14)10-6/h2,11H,1H2,(H2,7,12)(H2,8,9,10,13,14).
What are the key properties of 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide?
3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide has a molecular weight of 200.15 g/mol, XLogP of -3.57, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dioxoimidazolidin-2-ylidene)amino]-2-hydroxypropanamide is sourced from PubChem (CID 136849720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).