C20H22N4OS — CID 136850434
7-[(2,5-dimethylthiophen-3-yl)methyl]-2-pyridin-4-yl-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one (PubChem CID 136850434) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 7-[(2,5-dimethylthiophen-3-yl)methyl]-2-pyridin-4-yl-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-[(2,5-dimethylthiophen-3-yl)methyl]-2-pyridin-4-yl-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 136850434 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 7-[(2,5-dimethylthiophen-3-yl)methyl]-2-pyridin-4-yl-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
| SMILES | Cc1cc(CN2CCc3nc(-c4ccncc4)[nH]c(=O)c3CC2)c(C)s1 |
| InChI | InChI=1S/C20H22N4OS/c1-13-11-16(14(2)26-13)12-24-9-5-17-18(6-10-24)22-19(23-20(17)25)15-3-7-21-8-4-15/h3-4,7-8,11H,5-6,9-10,12H2,1-2H3,(H,22,23,25) |
| InChIKey | LXCKWZAVDJLEMR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |