C21H23N5O2 — CID 136851025
7-[(4-methoxy-2,3-dimethylphenyl)methyl]-2-pyrazin-2-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136851025) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 7-[(4-methoxy-2,3-dimethylphenyl)methyl]-2-pyrazin-2-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(4-methoxy-2,3-dimethylphenyl)methyl]-2-pyrazin-2-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136851025 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 7-[(4-methoxy-2,3-dimethylphenyl)methyl]-2-pyrazin-2-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1ccc(CN2CCc3c(nc(-c4cnccn4)[nH]c3=O)C2)c(C)c1C |
| InChI | InChI=1S/C21H23N5O2/c1-13-14(2)19(28-3)5-4-15(13)11-26-9-6-16-18(12-26)24-20(25-21(16)27)17-10-22-7-8-23-17/h4-5,7-8,10H,6,9,11-12H2,1-3H3,(H,24,25,27) |
| InChIKey | VSWORJXMEDCYJK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |