C21H33N5O3S — CID 136851146
2-[(3S)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-3-yl]-N,N-dimethyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-sulfonamide (PubChem CID 136851146) has the molecular formula C21H33N5O3S and a molecular weight of 435.59 g/mol. Its IUPAC name is 2-[(3S)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-3-yl]-N,N-dimethyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-sulfonamide.
| Compound Name | 2-[(3S)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-3-yl]-N,N-dimethyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-sulfonamide |
|---|---|
| PubChem CID | 136851146 |
| Molecular Formula | C21H33N5O3S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-[(3S)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-3-yl]-N,N-dimethyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCc2nc([C@H]3CCCN(C[C@H]4CC=CCC4)C3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C21H33N5O3S/c1-24(2)30(28,29)26-12-10-19-18(15-26)21(27)23-20(22-19)17-9-6-11-25(14-17)13-16-7-4-3-5-8-16/h3-4,16-17H,5-15H2,1-2H3,(H,22,23,27)/t16-,17-/m0/s1 |
| InChIKey | FHVUGNNLWAADPR-IRXDYDNUSA-N |
| XLogP | 1.47 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|