C10H17N3O4 — CID 136852190
4-(2,3-dimethoxypropylamino)-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136852190) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-(2,3-dimethoxypropylamino)-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-(2,3-dimethoxypropylamino)-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136852190 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 4-(2,3-dimethoxypropylamino)-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COCC(CNc1nc[nH]c(=O)c1OC)OC |
| InChI | InChI=1S/C10H17N3O4/c1-15-5-7(16-2)4-11-9-8(17-3)10(14)13-6-12-9/h6-7H,4-5H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | NYCBBLWXOPPCTA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |