C12H19N3O3 — CID 136852193
2-cyclopropyl-4-(2,3-dimethoxypropylamino)-1H-pyrimidin-6-one (PubChem CID 136852193) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,3-dimethoxypropylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(2,3-dimethoxypropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136852193 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-cyclopropyl-4-(2,3-dimethoxypropylamino)-1H-pyrimidin-6-one |
| SMILES | COCC(CNc1cc(=O)[nH]c(C2CC2)n1)OC |
| InChI | InChI=1S/C12H19N3O3/c1-17-7-9(18-2)6-13-10-5-11(16)15-12(14-10)8-3-4-8/h5,8-9H,3-4,6-7H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | VAIMXNVKWLJMBK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |